C18H19N3O2S — CID 4280912
5-(4-ethoxyphenyl)-2-oxo-4-sulfanyl-1,5-diazaspiro[5.5]undeca-3,10-diene-3-carbonitrile (PubChem CID 4280912) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 5-(4-ethoxyphenyl)-2-oxo-4-sulfanyl-1,5-diazaspiro[5.5]undeca-3,10-diene-3-carbonitrile.
| Compound Name | 5-(4-ethoxyphenyl)-2-oxo-4-sulfanyl-1,5-diazaspiro[5.5]undeca-3,10-diene-3-carbonitrile |
|---|---|
| PubChem CID | 4280912 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 5-(4-ethoxyphenyl)-2-oxo-4-sulfanyl-1,5-diazaspiro[5.5]undeca-3,10-diene-3-carbonitrile |
| SMILES | CCOc1ccc(N2C(S)=C(C#N)C(=O)NC23C=CCCC3)cc1 |
| InChI | InChI=1S/C18H19N3O2S/c1-2-23-14-8-6-13(7-9-14)21-17(24)15(12-19)16(22)20-18(21)10-4-3-5-11-18/h4,6-10,24H,2-3,5,11H2,1H3,(H,20,22) |
| InChIKey | IORZLUSNBBKABP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|