About 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepin-2-one
8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepin-2-one (PubChem CID 4280965) has the molecular formula C16H14N2O2
and a molecular weight of 266.30 g/mol. Its IUPAC name is 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepin-2-one |
| PubChem CID | 4280965 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepin-2-one |
| SMILES | COc1ccc2c(c1)NC(=O)CC(c1ccccc1)=N2 |
| InChI | InChI=1S/C16H14N2O2/c1-20-12-7-8-13-15(9-12)18-16(19)10-14(17-13)11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H,18,19) |
| InChIKey | QETBUEAWBCRBJW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepin-2-one?
The IUPAC name of 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepin-2-one (CID 4280965) is 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepin-2-one.
What is the SMILES notation for 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepin-2-one?
The canonical SMILES for 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepin-2-one is COc1ccc2c(c1)NC(=O)CC(c1ccccc1)=N2.
What is the InChIKey of 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepin-2-one?
The InChIKey is QETBUEAWBCRBJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O2/c1-20-12-7-8-13-15(9-12)18-16(19)10-14(17-13)11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H,18,19).
What are the key properties of 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepin-2-one?
8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepin-2-one has a molecular weight of 266.30 g/mol, XLogP of 3.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-4-phenyl-1,3-dihydro-1,5-benzodiazepin-2-one is sourced from PubChem (CID 4280965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).