C26H23F3N4O4 — CID 42810063
N-[4-[3-(2-methoxyethoxy)-5-(3-methoxyphenyl)-1,2,4-triazol-1-yl]phenyl]-4-(trifluoromethyl)benzamide (PubChem CID 42810063) has the molecular formula C26H23F3N4O4 and a molecular weight of 512.49 g/mol. Its IUPAC name is N-[4-[3-(2-methoxyethoxy)-5-(3-methoxyphenyl)-1,2,4-triazol-1-yl]phenyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[4-[3-(2-methoxyethoxy)-5-(3-methoxyphenyl)-1,2,4-triazol-1-yl]phenyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 42810063 |
| Molecular Formula | C26H23F3N4O4 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | N-[4-[3-(2-methoxyethoxy)-5-(3-methoxyphenyl)-1,2,4-triazol-1-yl]phenyl]-4-(trifluoromethyl)benzamide |
| SMILES | COCCOc1nc(-c2cccc(OC)c2)n(-c2ccc(NC(=O)c3ccc(C(F)(F)F)cc3)cc2)n1 |
| InChI | InChI=1S/C26H23F3N4O4/c1-35-14-15-37-25-31-23(18-4-3-5-22(16-18)36-2)33(32-25)21-12-10-20(11-13-21)30-24(34)17-6-8-19(9-7-17)26(27,28)29/h3-13,16H,14-15H2,1-2H3,(H,30,34) |
| InChIKey | OTVLRXDEBJCFCV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|