About 2-[7-chloro-3-(2,4-difluorophenyl)-2,4-dioxoquinazolin-1-yl]-N-methyl-N-propylacetamide
2-[7-chloro-3-(2,4-difluorophenyl)-2,4-dioxoquinazolin-1-yl]-N-methyl-N-propylacetamide (PubChem CID 42811202) has the molecular formula C20H18ClF2N3O3
and a molecular weight of 421.83 g/mol. Its IUPAC name is 2-[7-chloro-3-(2,4-difluorophenyl)-2,4-dioxoquinazolin-1-yl]-N-methyl-N-propylacetamide.
Molecular Properties
| Compound Name | 2-[7-chloro-3-(2,4-difluorophenyl)-2,4-dioxoquinazolin-1-yl]-N-methyl-N-propylacetamide |
| PubChem CID | 42811202 |
| Molecular Formula | C20H18ClF2N3O3 |
| Molecular Weight | 421.83 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 2-[7-chloro-3-(2,4-difluorophenyl)-2,4-dioxoquinazolin-1-yl]-N-methyl-N-propylacetamide |
| SMILES | CCCN(C)C(=O)Cn1c(=O)n(-c2ccc(F)cc2F)c(=O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C20H18ClF2N3O3/c1-3-8-24(2)18(27)11-25-17-9-12(21)4-6-14(17)19(28)26(20(25)29)16-7-5-13(22)10-15(16)23/h4-7,9-10H,3,8,11H2,1-2H3 |
| InChIKey | YSLKZADWZQULTG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.83 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[7-chloro-3-(2,4-difluorophenyl)-2,4-dioxoquinazolin-1-yl]-N-methyl-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[7-chloro-3-(2,4-difluorophenyl)-2,4-dioxoquinazolin-1-yl]-N-methyl-N-propylacetamide?
The IUPAC name of 2-[7-chloro-3-(2,4-difluorophenyl)-2,4-dioxoquinazolin-1-yl]-N-methyl-N-propylacetamide (CID 42811202) is 2-[7-chloro-3-(2,4-difluorophenyl)-2,4-dioxoquinazolin-1-yl]-N-methyl-N-propylacetamide.
What is the SMILES notation for 2-[7-chloro-3-(2,4-difluorophenyl)-2,4-dioxoquinazolin-1-yl]-N-methyl-N-propylacetamide?
The canonical SMILES for 2-[7-chloro-3-(2,4-difluorophenyl)-2,4-dioxoquinazolin-1-yl]-N-methyl-N-propylacetamide is CCCN(C)C(=O)Cn1c(=O)n(-c2ccc(F)cc2F)c(=O)c2ccc(Cl)cc21.
What is the InChIKey of 2-[7-chloro-3-(2,4-difluorophenyl)-2,4-dioxoquinazolin-1-yl]-N-methyl-N-propylacetamide?
The InChIKey is YSLKZADWZQULTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18ClF2N3O3/c1-3-8-24(2)18(27)11-25-17-9-12(21)4-6-14(17)19(28)26(20(25)29)16-7-5-13(22)10-15(16)23/h4-7,9-10H,3,8,11H2,1-2H3.
What are the key properties of 2-[7-chloro-3-(2,4-difluorophenyl)-2,4-dioxoquinazolin-1-yl]-N-methyl-N-propylacetamide?
2-[7-chloro-3-(2,4-difluorophenyl)-2,4-dioxoquinazolin-1-yl]-N-methyl-N-propylacetamide has a molecular weight of 421.83 g/mol, XLogP of 2.95, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[7-chloro-3-(2,4-difluorophenyl)-2,4-dioxoquinazolin-1-yl]-N-methyl-N-propylacetamide is sourced from PubChem (CID 42811202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).