C22H22FN3O — CID 42812200
[1-[4-(dimethylamino)phenyl]-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(3-fluorophenyl)methanone (PubChem CID 42812200) has the molecular formula C22H22FN3O and a molecular weight of 363.44 g/mol. Its IUPAC name is [1-[4-(dimethylamino)phenyl]-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(3-fluorophenyl)methanone.
| Compound Name | [1-[4-(dimethylamino)phenyl]-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 42812200 |
| Molecular Formula | C22H22FN3O |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | [1-[4-(dimethylamino)phenyl]-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(3-fluorophenyl)methanone |
| SMILES | CN(C)c1ccc(C2c3cccn3CCN2C(=O)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C22H22FN3O/c1-24(2)19-10-8-16(9-11-19)21-20-7-4-12-25(20)13-14-26(21)22(27)17-5-3-6-18(23)15-17/h3-12,15,21H,13-14H2,1-2H3 |
| InChIKey | YVIIXVFTSAKYKC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|