C10H4N4O6 — CID 4281403
2,8-dioxo-1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-4,10-dicarboxylic acid (PubChem CID 4281403) has the molecular formula C10H4N4O6 and a molecular weight of 276.16 g/mol. Its IUPAC name is 2,8-dioxo-1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-4,10-dicarboxylic acid.
| Compound Name | 2,8-dioxo-1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-4,10-dicarboxylic acid |
|---|---|
| PubChem CID | 4281403 |
| Molecular Formula | C10H4N4O6 |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 2,8-dioxo-1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-4,10-dicarboxylic acid |
| SMILES | O=C(O)c1ncn2c(=O)c3c(C(=O)O)ncn3c(=O)c12 |
| InChI | InChI=1S/C10H4N4O6/c15-7-6-4(10(19)20)12-2-14(6)8(16)5-3(9(17)18)11-1-13(5)7/h1-2H,(H,17,18)(H,19,20) |
| InChIKey | QLKMAJLWDKHCKY-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 143.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |