About 3-[2-(2-chlorophenyl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]-N,N-dimethylpropanamide
3-[2-(2-chlorophenyl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]-N,N-dimethylpropanamide (PubChem CID 42814398) has the molecular formula C15H19ClN2O2S
and a molecular weight of 326.85 g/mol. Its IUPAC name is 3-[2-(2-chlorophenyl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-[2-(2-chlorophenyl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]-N,N-dimethylpropanamide |
| PubChem CID | 42814398 |
| Molecular Formula | C15H19ClN2O2S |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 3-[2-(2-chlorophenyl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]-N,N-dimethylpropanamide |
| SMILES | CC1SC(c2ccccc2Cl)N(CCC(=O)N(C)C)C1=O |
| InChI | InChI=1S/C15H19ClN2O2S/c1-10-14(20)18(9-8-13(19)17(2)3)15(21-10)11-6-4-5-7-12(11)16/h4-7,10,15H,8-9H2,1-3H3 |
| InChIKey | QPEWADSIVFLTKX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(2-chlorophenyl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2-chlorophenyl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]-N,N-dimethylpropanamide?
The IUPAC name of 3-[2-(2-chlorophenyl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]-N,N-dimethylpropanamide (CID 42814398) is 3-[2-(2-chlorophenyl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]-N,N-dimethylpropanamide.
What is the SMILES notation for 3-[2-(2-chlorophenyl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]-N,N-dimethylpropanamide?
The canonical SMILES for 3-[2-(2-chlorophenyl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]-N,N-dimethylpropanamide is CC1SC(c2ccccc2Cl)N(CCC(=O)N(C)C)C1=O.
What is the InChIKey of 3-[2-(2-chlorophenyl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]-N,N-dimethylpropanamide?
The InChIKey is QPEWADSIVFLTKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19ClN2O2S/c1-10-14(20)18(9-8-13(19)17(2)3)15(21-10)11-6-4-5-7-12(11)16/h4-7,10,15H,8-9H2,1-3H3.
What are the key properties of 3-[2-(2-chlorophenyl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]-N,N-dimethylpropanamide?
3-[2-(2-chlorophenyl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]-N,N-dimethylpropanamide has a molecular weight of 326.85 g/mol, XLogP of 2.78, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-chlorophenyl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]-N,N-dimethylpropanamide is sourced from PubChem (CID 42814398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).