C23H26ClFN4O2 — CID 42817330
1-[3-(4-chlorophenyl)-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]-2-(2-morpholin-4-ylethylamino)ethanone (PubChem CID 42817330) has the molecular formula C23H26ClFN4O2 and a molecular weight of 444.94 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]-2-(2-morpholin-4-ylethylamino)ethanone.
| Compound Name | 1-[3-(4-chlorophenyl)-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]-2-(2-morpholin-4-ylethylamino)ethanone |
|---|---|
| PubChem CID | 42817330 |
| Molecular Formula | C23H26ClFN4O2 |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 1-[3-(4-chlorophenyl)-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]-2-(2-morpholin-4-ylethylamino)ethanone |
| SMILES | O=C(CNCCN1CCOCC1)N1N=C(c2ccc(F)cc2)CC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H26ClFN4O2/c24-19-5-1-18(2-6-19)22-15-21(17-3-7-20(25)8-4-17)27-29(22)23(30)16-26-9-10-28-11-13-31-14-12-28/h1-8,22,26H,9-16H2 |
| InChIKey | WZHMCUJRJURCLO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|