C17H27N3O4 — CID 4281802
methyl 2-[[butylcarbamoyl(cyclohexyl)amino]methyl]-1,3-oxazole-4-carboxylate (PubChem CID 4281802) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is methyl 2-[[butylcarbamoyl(cyclohexyl)amino]methyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[[butylcarbamoyl(cyclohexyl)amino]methyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 4281802 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | methyl 2-[[butylcarbamoyl(cyclohexyl)amino]methyl]-1,3-oxazole-4-carboxylate |
| SMILES | CCCCNC(=O)N(Cc1nc(C(=O)OC)co1)C1CCCCC1 |
| InChI | InChI=1S/C17H27N3O4/c1-3-4-10-18-17(22)20(13-8-6-5-7-9-13)11-15-19-14(12-24-15)16(21)23-2/h12-13H,3-11H2,1-2H3,(H,18,22) |
| InChIKey | QCCSFJDJFZTAMZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|