C21H31N3O — CID 42819409
3-methyl-N-[[1-[(3-methylphenyl)methyl]imidazol-2-yl]methyl]-N-(2-methylpropyl)butanamide (PubChem CID 42819409) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is 3-methyl-N-[[1-[(3-methylphenyl)methyl]imidazol-2-yl]methyl]-N-(2-methylpropyl)butanamide.
| Compound Name | 3-methyl-N-[[1-[(3-methylphenyl)methyl]imidazol-2-yl]methyl]-N-(2-methylpropyl)butanamide |
|---|---|
| PubChem CID | 42819409 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | 3-methyl-N-[[1-[(3-methylphenyl)methyl]imidazol-2-yl]methyl]-N-(2-methylpropyl)butanamide |
| SMILES | Cc1cccc(Cn2ccnc2CN(CC(C)C)C(=O)CC(C)C)c1 |
| InChI | InChI=1S/C21H31N3O/c1-16(2)11-21(25)24(13-17(3)4)15-20-22-9-10-23(20)14-19-8-6-7-18(5)12-19/h6-10,12,16-17H,11,13-15H2,1-5H3 |
| InChIKey | PKPHJNVQHRZEOI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |