About N-[[1-[(3,4-dichlorophenyl)methyl]imidazol-2-yl]methyl]-N-[2-(dimethylamino)ethyl]acetamide
N-[[1-[(3,4-dichlorophenyl)methyl]imidazol-2-yl]methyl]-N-[2-(dimethylamino)ethyl]acetamide (PubChem CID 42819588) has the molecular formula C17H22Cl2N4O
and a molecular weight of 369.30 g/mol. Its IUPAC name is N-[[1-[(3,4-dichlorophenyl)methyl]imidazol-2-yl]methyl]-N-[2-(dimethylamino)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[[1-[(3,4-dichlorophenyl)methyl]imidazol-2-yl]methyl]-N-[2-(dimethylamino)ethyl]acetamide |
| PubChem CID | 42819588 |
| Molecular Formula | C17H22Cl2N4O |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | N-[[1-[(3,4-dichlorophenyl)methyl]imidazol-2-yl]methyl]-N-[2-(dimethylamino)ethyl]acetamide |
| SMILES | CC(=O)N(CCN(C)C)Cc1nccn1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H22Cl2N4O/c1-13(24)22(9-8-21(2)3)12-17-20-6-7-23(17)11-14-4-5-15(18)16(19)10-14/h4-7,10H,8-9,11-12H2,1-3H3 |
| InChIKey | OSARXNSTRUQWOE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[1-[(3,4-dichlorophenyl)methyl]imidazol-2-yl]methyl]-N-[2-(dimethylamino)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-[(3,4-dichlorophenyl)methyl]imidazol-2-yl]methyl]-N-[2-(dimethylamino)ethyl]acetamide?
The IUPAC name of N-[[1-[(3,4-dichlorophenyl)methyl]imidazol-2-yl]methyl]-N-[2-(dimethylamino)ethyl]acetamide (CID 42819588) is N-[[1-[(3,4-dichlorophenyl)methyl]imidazol-2-yl]methyl]-N-[2-(dimethylamino)ethyl]acetamide.
What is the SMILES notation for N-[[1-[(3,4-dichlorophenyl)methyl]imidazol-2-yl]methyl]-N-[2-(dimethylamino)ethyl]acetamide?
The canonical SMILES for N-[[1-[(3,4-dichlorophenyl)methyl]imidazol-2-yl]methyl]-N-[2-(dimethylamino)ethyl]acetamide is CC(=O)N(CCN(C)C)Cc1nccn1Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of N-[[1-[(3,4-dichlorophenyl)methyl]imidazol-2-yl]methyl]-N-[2-(dimethylamino)ethyl]acetamide?
The InChIKey is OSARXNSTRUQWOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22Cl2N4O/c1-13(24)22(9-8-21(2)3)12-17-20-6-7-23(17)11-14-4-5-15(18)16(19)10-14/h4-7,10H,8-9,11-12H2,1-3H3.
What are the key properties of N-[[1-[(3,4-dichlorophenyl)methyl]imidazol-2-yl]methyl]-N-[2-(dimethylamino)ethyl]acetamide?
N-[[1-[(3,4-dichlorophenyl)methyl]imidazol-2-yl]methyl]-N-[2-(dimethylamino)ethyl]acetamide has a molecular weight of 369.30 g/mol, XLogP of 3.15, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-[(3,4-dichlorophenyl)methyl]imidazol-2-yl]methyl]-N-[2-(dimethylamino)ethyl]acetamide is sourced from PubChem (CID 42819588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).