About (4-methoxycarbonylphenyl)methyl 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate
(4-methoxycarbonylphenyl)methyl 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate (PubChem CID 4282054) has the molecular formula C24H21NO6
and a molecular weight of 419.43 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl)methyl 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate.
Molecular Properties
| Compound Name | (4-methoxycarbonylphenyl)methyl 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate |
| PubChem CID | 4282054 |
| Molecular Formula | C24H21NO6 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (4-methoxycarbonylphenyl)methyl 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)C2Cc3ccccc3CN2C(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C24H21NO6/c1-29-23(27)17-10-8-16(9-11-17)15-31-24(28)20-13-18-5-2-3-6-19(18)14-25(20)22(26)21-7-4-12-30-21/h2-12,20H,13-15H2,1H3 |
| InChIKey | KARMUHMYBCUXFF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-methoxycarbonylphenyl)methyl 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxycarbonylphenyl)methyl 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate?
The IUPAC name of (4-methoxycarbonylphenyl)methyl 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate (CID 4282054) is (4-methoxycarbonylphenyl)methyl 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate.
What is the SMILES notation for (4-methoxycarbonylphenyl)methyl 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate?
The canonical SMILES for (4-methoxycarbonylphenyl)methyl 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate is COC(=O)c1ccc(COC(=O)C2Cc3ccccc3CN2C(=O)c2ccco2)cc1.
What is the InChIKey of (4-methoxycarbonylphenyl)methyl 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate?
The InChIKey is KARMUHMYBCUXFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21NO6/c1-29-23(27)17-10-8-16(9-11-17)15-31-24(28)20-13-18-5-2-3-6-19(18)14-25(20)22(26)21-7-4-12-30-21/h2-12,20H,13-15H2,1H3.
What are the key properties of (4-methoxycarbonylphenyl)methyl 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate?
(4-methoxycarbonylphenyl)methyl 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate has a molecular weight of 419.43 g/mol, XLogP of 3.38, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxycarbonylphenyl)methyl 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate is sourced from PubChem (CID 4282054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).