C25H26ClN5OS — CID 4282166
N-(3-chlorophenyl)-2-[[5,7-dimethyl-6-[(2,4,6-trimethylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]sulfanyl]acetamide (PubChem CID 4282166) has the molecular formula C25H26ClN5OS and a molecular weight of 480.04 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[[5,7-dimethyl-6-[(2,4,6-trimethylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]sulfanyl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[[5,7-dimethyl-6-[(2,4,6-trimethylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4282166 |
| Molecular Formula | C25H26ClN5OS |
| Molecular Weight | 480.04 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | N-(3-chlorophenyl)-2-[[5,7-dimethyl-6-[(2,4,6-trimethylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]sulfanyl]acetamide |
| SMILES | Cc1cc(C)c(Cc2c(C)nc3nc(SCC(=O)Nc4cccc(Cl)c4)nn3c2C)c(C)c1 |
| InChI | InChI=1S/C25H26ClN5OS/c1-14-9-15(2)21(16(3)10-14)12-22-17(4)27-24-29-25(30-31(24)18(22)5)33-13-23(32)28-20-8-6-7-19(26)11-20/h6-11H,12-13H2,1-5H3,(H,28,32) |
| InChIKey | RZRBCUFSYQGZAA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.04 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |