About 6-chloro-2-(3,4-dimethoxyphenyl)-2,3-dihydrochromen-4-one
6-chloro-2-(3,4-dimethoxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 4282475) has the molecular formula C17H15ClO4
and a molecular weight of 318.76 g/mol. Its IUPAC name is 6-chloro-2-(3,4-dimethoxyphenyl)-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 6-chloro-2-(3,4-dimethoxyphenyl)-2,3-dihydrochromen-4-one |
| PubChem CID | 4282475 |
| Molecular Formula | C17H15ClO4 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 6-chloro-2-(3,4-dimethoxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc(C2CC(=O)c3cc(Cl)ccc3O2)cc1OC |
| InChI | InChI=1S/C17H15ClO4/c1-20-15-5-3-10(7-17(15)21-2)16-9-13(19)12-8-11(18)4-6-14(12)22-16/h3-8,16H,9H2,1-2H3 |
| InChIKey | VWGNKHPAHTYIRK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-2-(3,4-dimethoxyphenyl)-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-(3,4-dimethoxyphenyl)-2,3-dihydrochromen-4-one?
The IUPAC name of 6-chloro-2-(3,4-dimethoxyphenyl)-2,3-dihydrochromen-4-one (CID 4282475) is 6-chloro-2-(3,4-dimethoxyphenyl)-2,3-dihydrochromen-4-one.
What is the SMILES notation for 6-chloro-2-(3,4-dimethoxyphenyl)-2,3-dihydrochromen-4-one?
The canonical SMILES for 6-chloro-2-(3,4-dimethoxyphenyl)-2,3-dihydrochromen-4-one is COc1ccc(C2CC(=O)c3cc(Cl)ccc3O2)cc1OC.
What is the InChIKey of 6-chloro-2-(3,4-dimethoxyphenyl)-2,3-dihydrochromen-4-one?
The InChIKey is VWGNKHPAHTYIRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClO4/c1-20-15-5-3-10(7-17(15)21-2)16-9-13(19)12-8-11(18)4-6-14(12)22-16/h3-8,16H,9H2,1-2H3.
What are the key properties of 6-chloro-2-(3,4-dimethoxyphenyl)-2,3-dihydrochromen-4-one?
6-chloro-2-(3,4-dimethoxyphenyl)-2,3-dihydrochromen-4-one has a molecular weight of 318.76 g/mol, XLogP of 4.06, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-(3,4-dimethoxyphenyl)-2,3-dihydrochromen-4-one is sourced from PubChem (CID 4282475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).