C26H33N5O2 — CID 42825392
2-(2-morpholin-4-ylethylamino)-N-[4-phenyl-1-(4-propan-2-ylphenyl)imidazol-2-yl]acetamide (PubChem CID 42825392) has the molecular formula C26H33N5O2 and a molecular weight of 447.58 g/mol. Its IUPAC name is 2-(2-morpholin-4-ylethylamino)-N-[4-phenyl-1-(4-propan-2-ylphenyl)imidazol-2-yl]acetamide.
| Compound Name | 2-(2-morpholin-4-ylethylamino)-N-[4-phenyl-1-(4-propan-2-ylphenyl)imidazol-2-yl]acetamide |
|---|---|
| PubChem CID | 42825392 |
| Molecular Formula | C26H33N5O2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | 2-(2-morpholin-4-ylethylamino)-N-[4-phenyl-1-(4-propan-2-ylphenyl)imidazol-2-yl]acetamide |
| SMILES | CC(C)c1ccc(-n2cc(-c3ccccc3)nc2NC(=O)CNCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C26H33N5O2/c1-20(2)21-8-10-23(11-9-21)31-19-24(22-6-4-3-5-7-22)28-26(31)29-25(32)18-27-12-13-30-14-16-33-17-15-30/h3-11,19-20,27H,12-18H2,1-2H3,(H,28,29,32) |
| InChIKey | QENRECLQNUROOI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|