C23H31N3O2S — CID 42826183
1-[1-(2-ethyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)ethyl]-3-(3-methylphenyl)thiourea (PubChem CID 42826183) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is 1-[1-(2-ethyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)ethyl]-3-(3-methylphenyl)thiourea.
| Compound Name | 1-[1-(2-ethyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)ethyl]-3-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 42826183 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 1-[1-(2-ethyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)ethyl]-3-(3-methylphenyl)thiourea |
| SMILES | CCN1CCc2cc(OC)c(OC)cc2C1C(C)NC(=S)Nc1cccc(C)c1 |
| InChI | InChI=1S/C23H31N3O2S/c1-6-26-11-10-17-13-20(27-4)21(28-5)14-19(17)22(26)16(3)24-23(29)25-18-9-7-8-15(2)12-18/h7-9,12-14,16,22H,6,10-11H2,1-5H3,(H2,24,25,29) |
| InChIKey | HMVGLKZNAHPFBG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|