C24H32FN3O2S — CID 42827022
1-ethyl-3-[1-[2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]propyl]thiourea (PubChem CID 42827022) has the molecular formula C24H32FN3O2S and a molecular weight of 445.60 g/mol. Its IUPAC name is 1-ethyl-3-[1-[2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]propyl]thiourea.
| Compound Name | 1-ethyl-3-[1-[2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]propyl]thiourea |
|---|---|
| PubChem CID | 42827022 |
| Molecular Formula | C24H32FN3O2S |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 1-ethyl-3-[1-[2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]propyl]thiourea |
| SMILES | CCNC(=S)NC(CC)C1c2cc(OC)c(OC)cc2CCN1Cc1ccccc1F |
| InChI | InChI=1S/C24H32FN3O2S/c1-5-20(27-24(31)26-6-2)23-18-14-22(30-4)21(29-3)13-16(18)11-12-28(23)15-17-9-7-8-10-19(17)25/h7-10,13-14,20,23H,5-6,11-12,15H2,1-4H3,(H2,26,27,31) |
| InChIKey | XEFWKQJTKMFAMM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|