C24H23N5O5S — CID 42831079
methyl 7-ethyl-5-(3-nitrophenyl)-3-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 42831079) has the molecular formula C24H23N5O5S and a molecular weight of 493.55 g/mol. Its IUPAC name is methyl 7-ethyl-5-(3-nitrophenyl)-3-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | methyl 7-ethyl-5-(3-nitrophenyl)-3-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 42831079 |
| Molecular Formula | C24H23N5O5S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | methyl 7-ethyl-5-(3-nitrophenyl)-3-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCC1=C(C(=O)OC)C(c2cccc([N+](=O)[O-])c2)N2C(CC(=O)NCc3cccnc3)=CSC2=N1 |
| InChI | InChI=1S/C24H23N5O5S/c1-3-19-21(23(31)34-2)22(16-7-4-8-17(10-16)29(32)33)28-18(14-35-24(28)27-19)11-20(30)26-13-15-6-5-9-25-12-15/h4-10,12,14,22H,3,11,13H2,1-2H3,(H,26,30) |
| InChIKey | INCQKYIRQBGJCF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 127.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|