C27H28N4O5S — CID 42831741
propan-2-yl 3-[2-[benzyl(methyl)amino]-2-oxoethyl]-7-methyl-5-(4-nitrophenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 42831741) has the molecular formula C27H28N4O5S and a molecular weight of 520.61 g/mol. Its IUPAC name is propan-2-yl 3-[2-[benzyl(methyl)amino]-2-oxoethyl]-7-methyl-5-(4-nitrophenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | propan-2-yl 3-[2-[benzyl(methyl)amino]-2-oxoethyl]-7-methyl-5-(4-nitrophenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 42831741 |
| Molecular Formula | C27H28N4O5S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | propan-2-yl 3-[2-[benzyl(methyl)amino]-2-oxoethyl]-7-methyl-5-(4-nitrophenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)C(c2ccc([N+](=O)[O-])cc2)N2C(CC(=O)N(C)Cc3ccccc3)=CSC2=N1 |
| InChI | InChI=1S/C27H28N4O5S/c1-17(2)36-26(33)24-18(3)28-27-30(25(24)20-10-12-21(13-11-20)31(34)35)22(16-37-27)14-23(32)29(4)15-19-8-6-5-7-9-19/h5-13,16-17,25H,14-15H2,1-4H3 |
| InChIKey | LCRKWCQPLFXPSL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 105.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|