C25H34N6O4 — CID 42833418
1-[2-[4-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]piperazin-1-yl]-2-oxoethyl]-1-prop-2-enyl-3-propylurea (PubChem CID 42833418) has the molecular formula C25H34N6O4 and a molecular weight of 482.59 g/mol. Its IUPAC name is 1-[2-[4-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]piperazin-1-yl]-2-oxoethyl]-1-prop-2-enyl-3-propylurea.
| Compound Name | 1-[2-[4-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]piperazin-1-yl]-2-oxoethyl]-1-prop-2-enyl-3-propylurea |
|---|---|
| PubChem CID | 42833418 |
| Molecular Formula | C25H34N6O4 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | 1-[2-[4-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]piperazin-1-yl]-2-oxoethyl]-1-prop-2-enyl-3-propylurea |
| SMILES | C=CCN(CC(=O)N1CCN(c2ccc(-c3ccc(OC)c(OC)c3)nn2)CC1)C(=O)NCCC |
| InChI | InChI=1S/C25H34N6O4/c1-5-11-26-25(33)31(12-6-2)18-24(32)30-15-13-29(14-16-30)23-10-8-20(27-28-23)19-7-9-21(34-3)22(17-19)35-4/h6-10,17H,2,5,11-16,18H2,1,3-4H3,(H,26,33) |
| InChIKey | BNLSWBDYZDEBRR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|