C27H28ClFN6O2 — CID 42835273
3-(3-chlorophenyl)-1-[2-[4-[6-(4-fluorophenyl)pyridazin-3-yl]-1,4-diazepan-1-yl]-2-oxoethyl]-1-prop-2-enylurea (PubChem CID 42835273) has the molecular formula C27H28ClFN6O2 and a molecular weight of 523.01 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[2-[4-[6-(4-fluorophenyl)pyridazin-3-yl]-1,4-diazepan-1-yl]-2-oxoethyl]-1-prop-2-enylurea.
| Compound Name | 3-(3-chlorophenyl)-1-[2-[4-[6-(4-fluorophenyl)pyridazin-3-yl]-1,4-diazepan-1-yl]-2-oxoethyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 42835273 |
| Molecular Formula | C27H28ClFN6O2 |
| Molecular Weight | 523.01 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[2-[4-[6-(4-fluorophenyl)pyridazin-3-yl]-1,4-diazepan-1-yl]-2-oxoethyl]-1-prop-2-enylurea |
| SMILES | C=CCN(CC(=O)N1CCCN(c2ccc(-c3ccc(F)cc3)nn2)CC1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C27H28ClFN6O2/c1-2-13-35(27(37)30-23-6-3-5-21(28)18-23)19-26(36)34-15-4-14-33(16-17-34)25-12-11-24(31-32-25)20-7-9-22(29)10-8-20/h2-3,5-12,18H,1,4,13-17,19H2,(H,30,37) |
| InChIKey | UXJXARPETJCJLL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.01 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|