C22H23ClN4O6 — CID 42836295
4-[(2-chlorophenyl)methyl]-2-(3,4-dimethoxyphenyl)-N-(2-methoxyethyl)-3,5-dioxo-1,2,4-triazine-6-carboxamide (PubChem CID 42836295) has the molecular formula C22H23ClN4O6 and a molecular weight of 474.90 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl]-2-(3,4-dimethoxyphenyl)-N-(2-methoxyethyl)-3,5-dioxo-1,2,4-triazine-6-carboxamide.
| Compound Name | 4-[(2-chlorophenyl)methyl]-2-(3,4-dimethoxyphenyl)-N-(2-methoxyethyl)-3,5-dioxo-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 42836295 |
| Molecular Formula | C22H23ClN4O6 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl]-2-(3,4-dimethoxyphenyl)-N-(2-methoxyethyl)-3,5-dioxo-1,2,4-triazine-6-carboxamide |
| SMILES | COCCNC(=O)c1nn(-c2ccc(OC)c(OC)c2)c(=O)n(Cc2ccccc2Cl)c1=O |
| InChI | InChI=1S/C22H23ClN4O6/c1-31-11-10-24-20(28)19-21(29)26(13-14-6-4-5-7-16(14)23)22(30)27(25-19)15-8-9-17(32-2)18(12-15)33-3/h4-9,12H,10-11,13H2,1-3H3,(H,24,28) |
| InChIKey | GHNRNKNTPAAVBV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|