C16H23NO2 — CID 42837648
1-[cyclopropyl-[(3-methoxyphenyl)methyl]amino]-2-methylbut-3-en-2-ol (PubChem CID 42837648) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-[cyclopropyl-[(3-methoxyphenyl)methyl]amino]-2-methylbut-3-en-2-ol.
| Compound Name | 1-[cyclopropyl-[(3-methoxyphenyl)methyl]amino]-2-methylbut-3-en-2-ol |
|---|---|
| PubChem CID | 42837648 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1-[cyclopropyl-[(3-methoxyphenyl)methyl]amino]-2-methylbut-3-en-2-ol |
| SMILES | C=CC(C)(O)CN(Cc1cccc(OC)c1)C1CC1 |
| InChI | InChI=1S/C16H23NO2/c1-4-16(2,18)12-17(14-8-9-14)11-13-6-5-7-15(10-13)19-3/h4-7,10,14,18H,1,8-9,11-12H2,2-3H3 |
| InChIKey | UMRCMRMIAQPPQL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|