C25H21N3O3S — CID 42838023
[3-cyclopropyl-1-phenyl-4-[4-(thiophene-2-carbonylamino)phenyl]pyrazol-5-yl] acetate (PubChem CID 42838023) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is [3-cyclopropyl-1-phenyl-4-[4-(thiophene-2-carbonylamino)phenyl]pyrazol-5-yl] acetate.
| Compound Name | [3-cyclopropyl-1-phenyl-4-[4-(thiophene-2-carbonylamino)phenyl]pyrazol-5-yl] acetate |
|---|---|
| PubChem CID | 42838023 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | [3-cyclopropyl-1-phenyl-4-[4-(thiophene-2-carbonylamino)phenyl]pyrazol-5-yl] acetate |
| SMILES | CC(=O)Oc1c(-c2ccc(NC(=O)c3cccs3)cc2)c(C2CC2)nn1-c1ccccc1 |
| InChI | InChI=1S/C25H21N3O3S/c1-16(29)31-25-22(23(18-9-10-18)27-28(25)20-6-3-2-4-7-20)17-11-13-19(14-12-17)26-24(30)21-8-5-15-32-21/h2-8,11-15,18H,9-10H2,1H3,(H,26,30) |
| InChIKey | RAWXJNCLUNILKD-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |