C28H27N3O4 — CID 42838137
[3-(2-methoxyphenyl)-4-[4-(2-methylpropanoylamino)phenyl]-1-phenylpyrazol-5-yl] acetate (PubChem CID 42838137) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is [3-(2-methoxyphenyl)-4-[4-(2-methylpropanoylamino)phenyl]-1-phenylpyrazol-5-yl] acetate.
| Compound Name | [3-(2-methoxyphenyl)-4-[4-(2-methylpropanoylamino)phenyl]-1-phenylpyrazol-5-yl] acetate |
|---|---|
| PubChem CID | 42838137 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | [3-(2-methoxyphenyl)-4-[4-(2-methylpropanoylamino)phenyl]-1-phenylpyrazol-5-yl] acetate |
| SMILES | COc1ccccc1-c1nn(-c2ccccc2)c(OC(C)=O)c1-c1ccc(NC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C28H27N3O4/c1-18(2)27(33)29-21-16-14-20(15-17-21)25-26(23-12-8-9-13-24(23)34-4)30-31(28(25)35-19(3)32)22-10-6-5-7-11-22/h5-18H,1-4H3,(H,29,33) |
| InChIKey | HNESIRUDXBWYJI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |