C28H33N3O3S — CID 42839474
5-(3,4-dimethylphenyl)-2-[[(2-hydroxy-3-phenylpropyl)-(3-methoxypropyl)amino]methyl]-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 42839474) has the molecular formula C28H33N3O3S and a molecular weight of 491.66 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-2-[[(2-hydroxy-3-phenylpropyl)-(3-methoxypropyl)amino]methyl]-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(3,4-dimethylphenyl)-2-[[(2-hydroxy-3-phenylpropyl)-(3-methoxypropyl)amino]methyl]-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 42839474 |
| Molecular Formula | C28H33N3O3S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-2-[[(2-hydroxy-3-phenylpropyl)-(3-methoxypropyl)amino]methyl]-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | COCCCN(Cc1nc2scc(-c3ccc(C)c(C)c3)c2c(=O)[nH]1)CC(O)Cc1ccccc1 |
| InChI | InChI=1S/C28H33N3O3S/c1-19-10-11-22(14-20(19)2)24-18-35-28-26(24)27(33)29-25(30-28)17-31(12-7-13-34-3)16-23(32)15-21-8-5-4-6-9-21/h4-6,8-11,14,18,23,32H,7,12-13,15-17H2,1-3H3,(H,29,30,33) |
| InChIKey | AOEDWEWMAZHWIA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|