C18H25N3O3S — CID 42839853
2-[[(2-hydroxy-3-prop-2-ynoxypropyl)-propan-2-ylamino]methyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 42839853) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is 2-[[(2-hydroxy-3-prop-2-ynoxypropyl)-propan-2-ylamino]methyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[(2-hydroxy-3-prop-2-ynoxypropyl)-propan-2-ylamino]methyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 42839853 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-[[(2-hydroxy-3-prop-2-ynoxypropyl)-propan-2-ylamino]methyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | C#CCOCC(O)CN(Cc1nc2sc(C)c(C)c2c(=O)[nH]1)C(C)C |
| InChI | InChI=1S/C18H25N3O3S/c1-6-7-24-10-14(22)8-21(11(2)3)9-15-19-17(23)16-12(4)13(5)25-18(16)20-15/h1,11,14,22H,7-10H2,2-5H3,(H,19,20,23) |
| InChIKey | VVTPQOLSESPSJA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|