C25H24ClN3O3S — CID 42840119
5-(3-chlorophenyl)-2-[[(2-hydroxy-3-phenoxypropyl)-prop-2-enylamino]methyl]-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 42840119) has the molecular formula C25H24ClN3O3S and a molecular weight of 482.01 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-2-[[(2-hydroxy-3-phenoxypropyl)-prop-2-enylamino]methyl]-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(3-chlorophenyl)-2-[[(2-hydroxy-3-phenoxypropyl)-prop-2-enylamino]methyl]-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 42840119 |
| Molecular Formula | C25H24ClN3O3S |
| Molecular Weight | 482.01 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | 5-(3-chlorophenyl)-2-[[(2-hydroxy-3-phenoxypropyl)-prop-2-enylamino]methyl]-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCN(Cc1nc2scc(-c3cccc(Cl)c3)c2c(=O)[nH]1)CC(O)COc1ccccc1 |
| InChI | InChI=1S/C25H24ClN3O3S/c1-2-11-29(13-19(30)15-32-20-9-4-3-5-10-20)14-22-27-24(31)23-21(16-33-25(23)28-22)17-7-6-8-18(26)12-17/h2-10,12,16,19,30H,1,11,13-15H2,(H,27,28,31) |
| InChIKey | OLDLNOVKHVJPSB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.01 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|