C24H31N3O2S — CID 42840135
5-(2,4-dimethylphenyl)-2-[[2-hydroxyhex-5-enyl(propyl)amino]methyl]-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 42840135) has the molecular formula C24H31N3O2S and a molecular weight of 425.60 g/mol. Its IUPAC name is 5-(2,4-dimethylphenyl)-2-[[2-hydroxyhex-5-enyl(propyl)amino]methyl]-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(2,4-dimethylphenyl)-2-[[2-hydroxyhex-5-enyl(propyl)amino]methyl]-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 42840135 |
| Molecular Formula | C24H31N3O2S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 5-(2,4-dimethylphenyl)-2-[[2-hydroxyhex-5-enyl(propyl)amino]methyl]-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCCC(O)CN(CCC)Cc1nc2scc(-c3ccc(C)cc3C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C24H31N3O2S/c1-5-7-8-18(28)13-27(11-6-2)14-21-25-23(29)22-20(15-30-24(22)26-21)19-10-9-16(3)12-17(19)4/h5,9-10,12,15,18,28H,1,6-8,11,13-14H2,2-4H3,(H,25,26,29) |
| InChIKey | MWYQSTZRAUDNFD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|