C20H17F2NO3S — CID 42841605
4-fluoro-N-(3-fluorophenyl)-N-[(4-methoxyphenyl)methyl]benzenesulfonamide (PubChem CID 42841605) has the molecular formula C20H17F2NO3S and a molecular weight of 389.42 g/mol. Its IUPAC name is 4-fluoro-N-(3-fluorophenyl)-N-[(4-methoxyphenyl)methyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-(3-fluorophenyl)-N-[(4-methoxyphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42841605 |
| Molecular Formula | C20H17F2NO3S |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 4-fluoro-N-(3-fluorophenyl)-N-[(4-methoxyphenyl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(CN(c2cccc(F)c2)S(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H17F2NO3S/c1-26-19-9-5-15(6-10-19)14-23(18-4-2-3-17(22)13-18)27(24,25)20-11-7-16(21)8-12-20/h2-13H,14H2,1H3 |
| InChIKey | AIPBYEYGWUZZNW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |