C25H32N4O3 — CID 42842421
2-cyclopentyl-2-[4-(2-phenoxyacetyl)piperazin-1-yl]-N-(pyridin-4-ylmethyl)acetamide (PubChem CID 42842421) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-cyclopentyl-2-[4-(2-phenoxyacetyl)piperazin-1-yl]-N-(pyridin-4-ylmethyl)acetamide.
| Compound Name | 2-cyclopentyl-2-[4-(2-phenoxyacetyl)piperazin-1-yl]-N-(pyridin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 42842421 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 2-cyclopentyl-2-[4-(2-phenoxyacetyl)piperazin-1-yl]-N-(pyridin-4-ylmethyl)acetamide |
| SMILES | O=C(NCc1ccncc1)C(C1CCCC1)N1CCN(C(=O)COc2ccccc2)CC1 |
| InChI | InChI=1S/C25H32N4O3/c30-23(19-32-22-8-2-1-3-9-22)28-14-16-29(17-15-28)24(21-6-4-5-7-21)25(31)27-18-20-10-12-26-13-11-20/h1-3,8-13,21,24H,4-7,14-19H2,(H,27,31) |
| InChIKey | NSOSAAYNBLCMRZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |