C24H31N3O2S — CID 42842497
2-cyclopentyl-N-(1-phenylethyl)-2-[4-(thiophene-2-carbonyl)piperazin-1-yl]acetamide (PubChem CID 42842497) has the molecular formula C24H31N3O2S and a molecular weight of 425.60 g/mol. Its IUPAC name is 2-cyclopentyl-N-(1-phenylethyl)-2-[4-(thiophene-2-carbonyl)piperazin-1-yl]acetamide.
| Compound Name | 2-cyclopentyl-N-(1-phenylethyl)-2-[4-(thiophene-2-carbonyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 42842497 |
| Molecular Formula | C24H31N3O2S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 2-cyclopentyl-N-(1-phenylethyl)-2-[4-(thiophene-2-carbonyl)piperazin-1-yl]acetamide |
| SMILES | CC(NC(=O)C(C1CCCC1)N1CCN(C(=O)c2cccs2)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H31N3O2S/c1-18(19-8-3-2-4-9-19)25-23(28)22(20-10-5-6-11-20)26-13-15-27(16-14-26)24(29)21-12-7-17-30-21/h2-4,7-9,12,17-18,20,22H,5-6,10-11,13-16H2,1H3,(H,25,28) |
| InChIKey | WMMLKGKWJHEDHQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |