C26H35N3O2 — CID 42843178
1-[[3-methyl-5-(3-methylphenoxy)-1-phenylpyrazol-4-yl]methyl-propylamino]pentan-2-ol (PubChem CID 42843178) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 1-[[3-methyl-5-(3-methylphenoxy)-1-phenylpyrazol-4-yl]methyl-propylamino]pentan-2-ol.
| Compound Name | 1-[[3-methyl-5-(3-methylphenoxy)-1-phenylpyrazol-4-yl]methyl-propylamino]pentan-2-ol |
|---|---|
| PubChem CID | 42843178 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 1-[[3-methyl-5-(3-methylphenoxy)-1-phenylpyrazol-4-yl]methyl-propylamino]pentan-2-ol |
| SMILES | CCCC(O)CN(CCC)Cc1c(C)nn(-c2ccccc2)c1Oc1cccc(C)c1 |
| InChI | InChI=1S/C26H35N3O2/c1-5-11-23(30)18-28(16-6-2)19-25-21(4)27-29(22-13-8-7-9-14-22)26(25)31-24-15-10-12-20(3)17-24/h7-10,12-15,17,23,30H,5-6,11,16,18-19H2,1-4H3 |
| InChIKey | LOVCZCYNTQKRNG-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |