C26H31N3O2 — CID 42844845
2-[cyclopentyl(prop-2-enyl)amino]-1-[3-(2-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 42844845) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is 2-[cyclopentyl(prop-2-enyl)amino]-1-[3-(2-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]ethanone.
| Compound Name | 2-[cyclopentyl(prop-2-enyl)amino]-1-[3-(2-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 42844845 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 2-[cyclopentyl(prop-2-enyl)amino]-1-[3-(2-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | C=CCN(CC(=O)N1N=C(c2ccccc2)CC1c1ccccc1OC)C1CCCC1 |
| InChI | InChI=1S/C26H31N3O2/c1-3-17-28(21-13-7-8-14-21)19-26(30)29-24(22-15-9-10-16-25(22)31-2)18-23(27-29)20-11-5-4-6-12-20/h3-6,9-12,15-16,21,24H,1,7-8,13-14,17-19H2,2H3 |
| InChIKey | LWQUXHWHQTYCPJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|