C26H31F2N3O2 — CID 42845309
1-[[5-(3-fluorophenoxy)-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methyl-propan-2-ylamino]hex-5-en-2-ol (PubChem CID 42845309) has the molecular formula C26H31F2N3O2 and a molecular weight of 455.55 g/mol. Its IUPAC name is 1-[[5-(3-fluorophenoxy)-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methyl-propan-2-ylamino]hex-5-en-2-ol.
| Compound Name | 1-[[5-(3-fluorophenoxy)-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methyl-propan-2-ylamino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 42845309 |
| Molecular Formula | C26H31F2N3O2 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 1-[[5-(3-fluorophenoxy)-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methyl-propan-2-ylamino]hex-5-en-2-ol |
| SMILES | C=CCCC(O)CN(Cc1c(C)nn(-c2ccc(F)cc2)c1Oc1cccc(F)c1)C(C)C |
| InChI | InChI=1S/C26H31F2N3O2/c1-5-6-9-23(32)16-30(18(2)3)17-25-19(4)29-31(22-13-11-20(27)12-14-22)26(25)33-24-10-7-8-21(28)15-24/h5,7-8,10-15,18,23,32H,1,6,9,16-17H2,2-4H3 |
| InChIKey | AYSKKOHZBXAIKG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|