C19H19ClN2O2 — CID 42847343
4-(4-chlorobenzoyl)-3-methyl-1-(3-methylphenyl)piperazin-2-one (PubChem CID 42847343) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 4-(4-chlorobenzoyl)-3-methyl-1-(3-methylphenyl)piperazin-2-one.
| Compound Name | 4-(4-chlorobenzoyl)-3-methyl-1-(3-methylphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 42847343 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 4-(4-chlorobenzoyl)-3-methyl-1-(3-methylphenyl)piperazin-2-one |
| SMILES | Cc1cccc(N2CCN(C(=O)c3ccc(Cl)cc3)C(C)C2=O)c1 |
| InChI | InChI=1S/C19H19ClN2O2/c1-13-4-3-5-17(12-13)22-11-10-21(14(2)18(22)23)19(24)15-6-8-16(20)9-7-15/h3-9,12,14H,10-11H2,1-2H3 |
| InChIKey | BMJUAYWRDLFERS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |