About N-(4-hydroxyphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide
N-(4-hydroxyphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide (PubChem CID 4284967) has the molecular formula C25H22N2O5
and a molecular weight of 430.46 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide.
Molecular Properties
| Compound Name | N-(4-hydroxyphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
| PubChem CID | 4284967 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | N-(4-hydroxyphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1cc(-c2cc(C(=O)Nc3ccc(O)cc3)c3ccccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C25H22N2O5/c1-30-22-12-15(13-23(31-2)24(22)32-3)21-14-19(18-6-4-5-7-20(18)27-21)25(29)26-16-8-10-17(28)11-9-16/h4-14,28H,1-3H3,(H,26,29) |
| InChIKey | VUYSSEQBALZIHX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze N-(4-hydroxyphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-hydroxyphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide?
The IUPAC name of N-(4-hydroxyphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide (CID 4284967) is N-(4-hydroxyphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide.
What is the SMILES notation for N-(4-hydroxyphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide?
The canonical SMILES for N-(4-hydroxyphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide is COc1cc(-c2cc(C(=O)Nc3ccc(O)cc3)c3ccccc3n2)cc(OC)c1OC.
What is the InChIKey of N-(4-hydroxyphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide?
The InChIKey is VUYSSEQBALZIHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22N2O5/c1-30-22-12-15(13-23(31-2)24(22)32-3)21-14-19(18-6-4-5-7-20(18)27-21)25(29)26-16-8-10-17(28)11-9-16/h4-14,28H,1-3H3,(H,26,29).
What are the key properties of N-(4-hydroxyphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide?
N-(4-hydroxyphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide has a molecular weight of 430.46 g/mol, XLogP of 4.89, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-hydroxyphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide is sourced from PubChem (CID 4284967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).