C29H34N2O3 — CID 42849833
N-(2-methoxyethyl)-2-[[2-[(3-methylphenyl)methyl]-1-phenyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]propanamide (PubChem CID 42849833) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[[2-[(3-methylphenyl)methyl]-1-phenyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]propanamide.
| Compound Name | N-(2-methoxyethyl)-2-[[2-[(3-methylphenyl)methyl]-1-phenyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]propanamide |
|---|---|
| PubChem CID | 42849833 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | N-(2-methoxyethyl)-2-[[2-[(3-methylphenyl)methyl]-1-phenyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]propanamide |
| SMILES | COCCNC(=O)C(C)Oc1ccc2c(c1)C(c1ccccc1)N(Cc1cccc(C)c1)CC2 |
| InChI | InChI=1S/C29H34N2O3/c1-21-8-7-9-23(18-21)20-31-16-14-24-12-13-26(34-22(2)29(32)30-15-17-33-3)19-27(24)28(31)25-10-5-4-6-11-25/h4-13,18-19,22,28H,14-17,20H2,1-3H3,(H,30,32) |
| InChIKey | QGQBOFSRLBMRMB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|