C20H22N6O3S — CID 4284998
1-[4-(benzenesulfonyl)piperazin-1-yl]-2-[5-(2-methylphenyl)tetrazol-2-yl]ethanone (PubChem CID 4284998) has the molecular formula C20H22N6O3S and a molecular weight of 426.50 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-[5-(2-methylphenyl)tetrazol-2-yl]ethanone.
| Compound Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-[5-(2-methylphenyl)tetrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 4284998 |
| Molecular Formula | C20H22N6O3S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-[5-(2-methylphenyl)tetrazol-2-yl]ethanone |
| SMILES | Cc1ccccc1-c1nnn(CC(=O)N2CCN(S(=O)(=O)c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C20H22N6O3S/c1-16-7-5-6-10-18(16)20-21-23-26(22-20)15-19(27)24-11-13-25(14-12-24)30(28,29)17-8-3-2-4-9-17/h2-10H,11-15H2,1H3 |
| InChIKey | SUXGKHPMHMOLPH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |