C26H31N3O2 — CID 42850708
5-[[4-(3,4-dimethylphenyl)piperazin-1-yl]methyl]-N-(1-phenylethyl)furan-2-carboxamide (PubChem CID 42850708) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is 5-[[4-(3,4-dimethylphenyl)piperazin-1-yl]methyl]-N-(1-phenylethyl)furan-2-carboxamide.
| Compound Name | 5-[[4-(3,4-dimethylphenyl)piperazin-1-yl]methyl]-N-(1-phenylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 42850708 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 5-[[4-(3,4-dimethylphenyl)piperazin-1-yl]methyl]-N-(1-phenylethyl)furan-2-carboxamide |
| SMILES | Cc1ccc(N2CCN(Cc3ccc(C(=O)NC(C)c4ccccc4)o3)CC2)cc1C |
| InChI | InChI=1S/C26H31N3O2/c1-19-9-10-23(17-20(19)2)29-15-13-28(14-16-29)18-24-11-12-25(31-24)26(30)27-21(3)22-7-5-4-6-8-22/h4-12,17,21H,13-16,18H2,1-3H3,(H,27,30) |
| InChIKey | SVRZLGPLMVIHFU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|