C22H25N3O4 — CID 42850808
N-(furan-2-ylmethyl)-5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]furan-2-carboxamide (PubChem CID 42850808) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]furan-2-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42850808 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N-(furan-2-ylmethyl)-5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]furan-2-carboxamide |
| SMILES | COc1ccccc1N1CCN(Cc2ccc(C(=O)NCc3ccco3)o2)CC1 |
| InChI | InChI=1S/C22H25N3O4/c1-27-20-7-3-2-6-19(20)25-12-10-24(11-13-25)16-18-8-9-21(29-18)22(26)23-15-17-5-4-14-28-17/h2-9,14H,10-13,15-16H2,1H3,(H,23,26) |
| InChIKey | ZYBBDLPAWOQAEW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |