C19H25N3O2 — CID 42850852
5-[(4-methylpiperidin-1-yl)methyl]-N-(2-pyridin-2-ylethyl)furan-2-carboxamide (PubChem CID 42850852) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 5-[(4-methylpiperidin-1-yl)methyl]-N-(2-pyridin-2-ylethyl)furan-2-carboxamide.
| Compound Name | 5-[(4-methylpiperidin-1-yl)methyl]-N-(2-pyridin-2-ylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 42850852 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 5-[(4-methylpiperidin-1-yl)methyl]-N-(2-pyridin-2-ylethyl)furan-2-carboxamide |
| SMILES | CC1CCN(Cc2ccc(C(=O)NCCc3ccccn3)o2)CC1 |
| InChI | InChI=1S/C19H25N3O2/c1-15-8-12-22(13-9-15)14-17-5-6-18(24-17)19(23)21-11-7-16-4-2-3-10-20-16/h2-6,10,15H,7-9,11-14H2,1H3,(H,21,23) |
| InChIKey | PZMCAAANHTZLCH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |