C34H31N5 — CID 4285177
8-benzyl-14-methyl-12-phenyl-16-(4-propan-2-ylphenyl)-1,8,10,12,13-pentazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,9,11(15),13-hexaene (PubChem CID 4285177) has the molecular formula C34H31N5 and a molecular weight of 509.66 g/mol. Its IUPAC name is 8-benzyl-14-methyl-12-phenyl-16-(4-propan-2-ylphenyl)-1,8,10,12,13-pentazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,9,11(15),13-hexaene.
| Compound Name | 8-benzyl-14-methyl-12-phenyl-16-(4-propan-2-ylphenyl)-1,8,10,12,13-pentazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,9,11(15),13-hexaene |
|---|---|
| PubChem CID | 4285177 |
| Molecular Formula | C34H31N5 |
| Molecular Weight | 509.66 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | 8-benzyl-14-methyl-12-phenyl-16-(4-propan-2-ylphenyl)-1,8,10,12,13-pentazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,9,11(15),13-hexaene |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(c1ccc(C(C)C)cc1)N1C(=N2)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C34H31N5/c1-23(2)26-18-20-27(21-19-26)32-31-24(3)36-39(28-14-8-5-9-15-28)33(31)35-34-37(22-25-12-6-4-7-13-25)29-16-10-11-17-30(29)38(32)34/h4-21,23,32H,22H2,1-3H3 |
| InChIKey | AMEUHYBXESEOSO-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 36.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.66 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |