C26H28FN3O6S — CID 42853460
N-(3,4-dimethoxyphenyl)-4-fluoro-N-[1-[(3-nitrophenyl)methyl]piperidin-4-yl]benzenesulfonamide (PubChem CID 42853460) has the molecular formula C26H28FN3O6S and a molecular weight of 529.59 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-4-fluoro-N-[1-[(3-nitrophenyl)methyl]piperidin-4-yl]benzenesulfonamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-4-fluoro-N-[1-[(3-nitrophenyl)methyl]piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 42853460 |
| Molecular Formula | C26H28FN3O6S |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-4-fluoro-N-[1-[(3-nitrophenyl)methyl]piperidin-4-yl]benzenesulfonamide |
| SMILES | COc1ccc(N(C2CCN(Cc3cccc([N+](=O)[O-])c3)CC2)S(=O)(=O)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C26H28FN3O6S/c1-35-25-11-8-22(17-26(25)36-2)29(37(33,34)24-9-6-20(27)7-10-24)21-12-14-28(15-13-21)18-19-4-3-5-23(16-19)30(31)32/h3-11,16-17,21H,12-15,18H2,1-2H3 |
| InChIKey | MKDRVTMAWBKFMM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|