C24H29N3O4 — CID 42853624
N-(2-morpholin-4-ylethyl)-2-oxo-1-(4-phenylmethoxyphenyl)pyrrolidine-3-carboxamide (PubChem CID 42853624) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-2-oxo-1-(4-phenylmethoxyphenyl)pyrrolidine-3-carboxamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-2-oxo-1-(4-phenylmethoxyphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42853624 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-2-oxo-1-(4-phenylmethoxyphenyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)C1CCN(c2ccc(OCc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C24H29N3O4/c28-23(25-11-13-26-14-16-30-17-15-26)22-10-12-27(24(22)29)20-6-8-21(9-7-20)31-18-19-4-2-1-3-5-19/h1-9,22H,10-18H2,(H,25,28) |
| InChIKey | PUGNXJJXDXIJAL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|