C23H21F2NO3 — CID 42854576
benzyl 4-(2,4-difluorophenyl)-6-methyl-2-oxo-1-prop-2-enyl-3,4-dihydropyridine-5-carboxylate (PubChem CID 42854576) has the molecular formula C23H21F2NO3 and a molecular weight of 397.42 g/mol. Its IUPAC name is benzyl 4-(2,4-difluorophenyl)-6-methyl-2-oxo-1-prop-2-enyl-3,4-dihydropyridine-5-carboxylate.
| Compound Name | benzyl 4-(2,4-difluorophenyl)-6-methyl-2-oxo-1-prop-2-enyl-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 42854576 |
| Molecular Formula | C23H21F2NO3 |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | benzyl 4-(2,4-difluorophenyl)-6-methyl-2-oxo-1-prop-2-enyl-3,4-dihydropyridine-5-carboxylate |
| SMILES | C=CCN1C(=O)CC(c2ccc(F)cc2F)C(C(=O)OCc2ccccc2)=C1C |
| InChI | InChI=1S/C23H21F2NO3/c1-3-11-26-15(2)22(23(28)29-14-16-7-5-4-6-8-16)19(13-21(26)27)18-10-9-17(24)12-20(18)25/h3-10,12,19H,1,11,13-14H2,2H3 |
| InChIKey | GNFYVIQOEQOMPP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|