C23H22F3N5O — CID 42857326
N-[6-[4-(pyridin-4-ylmethyl)piperazin-1-yl]-3-pyridinyl]-4-(trifluoromethyl)benzamide (PubChem CID 42857326) has the molecular formula C23H22F3N5O and a molecular weight of 441.46 g/mol. Its IUPAC name is N-[6-[4-(pyridin-4-ylmethyl)piperazin-1-yl]-3-pyridinyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[6-[4-(pyridin-4-ylmethyl)piperazin-1-yl]-3-pyridinyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 42857326 |
| Molecular Formula | C23H22F3N5O |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | N-[6-[4-(pyridin-4-ylmethyl)piperazin-1-yl]-3-pyridinyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCN(Cc3ccncc3)CC2)nc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H22F3N5O/c24-23(25,26)19-3-1-18(2-4-19)22(32)29-20-5-6-21(28-15-20)31-13-11-30(12-14-31)16-17-7-9-27-10-8-17/h1-10,15H,11-14,16H2,(H,29,32) |
| InChIKey | NPKDXMFRGGEINI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |