C30H30N4O2 — CID 42857364
4-methyl-N-[6-[4-[(3-phenoxyphenyl)methyl]piperazin-1-yl]-3-pyridinyl]benzamide (PubChem CID 42857364) has the molecular formula C30H30N4O2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 4-methyl-N-[6-[4-[(3-phenoxyphenyl)methyl]piperazin-1-yl]-3-pyridinyl]benzamide.
| Compound Name | 4-methyl-N-[6-[4-[(3-phenoxyphenyl)methyl]piperazin-1-yl]-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 42857364 |
| Molecular Formula | C30H30N4O2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 4-methyl-N-[6-[4-[(3-phenoxyphenyl)methyl]piperazin-1-yl]-3-pyridinyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCN(Cc4cccc(Oc5ccccc5)c4)CC3)nc2)cc1 |
| InChI | InChI=1S/C30H30N4O2/c1-23-10-12-25(13-11-23)30(35)32-26-14-15-29(31-21-26)34-18-16-33(17-19-34)22-24-6-5-9-28(20-24)36-27-7-3-2-4-8-27/h2-15,20-21H,16-19,22H2,1H3,(H,32,35) |
| InChIKey | AJHMEFITLXPXDC-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |