C19H29N3O4 — CID 42861666
N-[2-(dimethylamino)ethyl]-N-[[4-(2-methoxyacetyl)morpholin-2-yl]methyl]benzamide (PubChem CID 42861666) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-[[4-(2-methoxyacetyl)morpholin-2-yl]methyl]benzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-[[4-(2-methoxyacetyl)morpholin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 42861666 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-[[4-(2-methoxyacetyl)morpholin-2-yl]methyl]benzamide |
| SMILES | COCC(=O)N1CCOC(CN(CCN(C)C)C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C19H29N3O4/c1-20(2)9-10-22(19(24)16-7-5-4-6-8-16)14-17-13-21(11-12-26-17)18(23)15-25-3/h4-8,17H,9-15H2,1-3H3 |
| InChIKey | YMWGQNZUUUXDPR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |