C24H28ClN3O4 — CID 42861858
(4-chlorophenyl)-[2-[[4-(2-methoxybenzoyl)piperazin-1-yl]methyl]morpholin-4-yl]methanone (PubChem CID 42861858) has the molecular formula C24H28ClN3O4 and a molecular weight of 457.96 g/mol. Its IUPAC name is (4-chlorophenyl)-[2-[[4-(2-methoxybenzoyl)piperazin-1-yl]methyl]morpholin-4-yl]methanone.
| Compound Name | (4-chlorophenyl)-[2-[[4-(2-methoxybenzoyl)piperazin-1-yl]methyl]morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 42861858 |
| Molecular Formula | C24H28ClN3O4 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | (4-chlorophenyl)-[2-[[4-(2-methoxybenzoyl)piperazin-1-yl]methyl]morpholin-4-yl]methanone |
| SMILES | COc1ccccc1C(=O)N1CCN(CC2CN(C(=O)c3ccc(Cl)cc3)CCO2)CC1 |
| InChI | InChI=1S/C24H28ClN3O4/c1-31-22-5-3-2-4-21(22)24(30)27-12-10-26(11-13-27)16-20-17-28(14-15-32-20)23(29)18-6-8-19(25)9-7-18/h2-9,20H,10-17H2,1H3 |
| InChIKey | HEZJYCPIWHFNDN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |